About 1,1-dichloroethene;1-ethenylpyrrolidin-2-one
1,1-dichloroethene;1-ethenylpyrrolidin-2-one (PubChem CID 19798230) has the molecular formula C8H11Cl2NO
and a molecular weight of 208.09 g/mol. Its IUPAC name is 1,1-dichloroethene;1-ethenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 1,1-dichloroethene;1-ethenylpyrrolidin-2-one |
| PubChem CID | 19798230 |
| Molecular Formula | C8H11Cl2NO |
| Molecular Weight | 208.09 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 1,1-dichloroethene;1-ethenylpyrrolidin-2-one |
| SMILES | C=C(Cl)Cl.C=CN1CCCC1=O |
| InChI | InChI=1S/C6H9NO.C2H2Cl2/c1-2-7-5-3-4-6(7)8;1-2(3)4/h2H,1,3-5H2;1H2 |
| InChIKey | XQJMDPGOPFPLJA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.09 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1-dichloroethene;1-ethenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloroethene;1-ethenylpyrrolidin-2-one?
The IUPAC name of 1,1-dichloroethene;1-ethenylpyrrolidin-2-one (CID 19798230) is 1,1-dichloroethene;1-ethenylpyrrolidin-2-one.
What is the SMILES notation for 1,1-dichloroethene;1-ethenylpyrrolidin-2-one?
The canonical SMILES for 1,1-dichloroethene;1-ethenylpyrrolidin-2-one is C=C(Cl)Cl.C=CN1CCCC1=O.
What is the InChIKey of 1,1-dichloroethene;1-ethenylpyrrolidin-2-one?
The InChIKey is XQJMDPGOPFPLJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C2H2Cl2/c1-2-7-5-3-4-6(7)8;1-2(3)4/h2H,1,3-5H2;1H2.
What are the key properties of 1,1-dichloroethene;1-ethenylpyrrolidin-2-one?
1,1-dichloroethene;1-ethenylpyrrolidin-2-one has a molecular weight of 208.09 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloroethene;1-ethenylpyrrolidin-2-one is sourced from PubChem (CID 19798230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).