C13H21NO4S2 — CID 19799084
(3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol;4-methylbenzenesulfonate (PubChem CID 19799084) has the molecular formula C13H21NO4S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol;4-methylbenzenesulfonate.
| Compound Name | (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 19799084 |
| Molecular Formula | C13H21NO4S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol;4-methylbenzenesulfonate |
| SMILES | C[N+]1(C)CSCC1CO.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O3S.C6H14NOS/c1-6-2-4-7(5-3-6)11(8,9)10;1-7(2)5-9-4-6(7)3-8/h2-5H,1H3,(H,8,9,10);6,8H,3-5H2,1-2H3/q;+1/p-1 |
| InChIKey | AHJBDOCYTIBFCD-UHFFFAOYSA-M |
| XLogP | 1.03 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|