About (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol
(3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol (PubChem CID 19799085) has the molecular formula C6H14NOS+
and a molecular weight of 148.25 g/mol. Its IUPAC name is (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol.
Molecular Properties
| Compound Name | (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol |
| PubChem CID | 19799085 |
| Molecular Formula | C6H14NOS+ |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol |
| SMILES | C[N+]1(C)CSCC1CO |
| InChI | InChI=1S/C6H14NOS/c1-7(2)5-9-4-6(7)3-8/h6,8H,3-5H2,1-2H3/q+1 |
| InChIKey | MVUTZOWQSYYQMX-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol?
The IUPAC name of (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol (CID 19799085) is (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol.
What is the SMILES notation for (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol?
The canonical SMILES for (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol is C[N+]1(C)CSCC1CO.
What is the InChIKey of (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol?
The InChIKey is MVUTZOWQSYYQMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14NOS/c1-7(2)5-9-4-6(7)3-8/h6,8H,3-5H2,1-2H3/q+1.
What are the key properties of (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol?
(3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol has a molecular weight of 148.25 g/mol, XLogP of 0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methanol is sourced from PubChem (CID 19799085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).