About 2-(4-hydroxyphenyl)-2,3-dihydro-1H-inden-5-ol
2-(4-hydroxyphenyl)-2,3-dihydro-1H-inden-5-ol (PubChem CID 19799155) has the molecular formula C15H14O2
and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | 2-(4-hydroxyphenyl)-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 19799155 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-(4-hydroxyphenyl)-2,3-dihydro-1H-inden-5-ol |
| SMILES | Oc1ccc(C2Cc3ccc(O)cc3C2)cc1 |
| InChI | InChI=1S/C15H14O2/c16-14-4-1-10(2-5-14)12-7-11-3-6-15(17)9-13(11)8-12/h1-6,9,12,16-17H,7-8H2 |
| InChIKey | WLUPSKSTWRDXEV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-hydroxyphenyl)-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxyphenyl)-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of 2-(4-hydroxyphenyl)-2,3-dihydro-1H-inden-5-ol (CID 19799155) is 2-(4-hydroxyphenyl)-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for 2-(4-hydroxyphenyl)-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for 2-(4-hydroxyphenyl)-2,3-dihydro-1H-inden-5-ol is Oc1ccc(C2Cc3ccc(O)cc3C2)cc1.
What is the InChIKey of 2-(4-hydroxyphenyl)-2,3-dihydro-1H-inden-5-ol?
The InChIKey is WLUPSKSTWRDXEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O2/c16-14-4-1-10(2-5-14)12-7-11-3-6-15(17)9-13(11)8-12/h1-6,9,12,16-17H,7-8H2.
What are the key properties of 2-(4-hydroxyphenyl)-2,3-dihydro-1H-inden-5-ol?
2-(4-hydroxyphenyl)-2,3-dihydro-1H-inden-5-ol has a molecular weight of 226.28 g/mol, XLogP of 2.98, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxyphenyl)-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 19799155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).