About 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-pentylsulfanylpyrazine;hydrochloride
2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-pentylsulfanylpyrazine;hydrochloride (PubChem CID 19800174) has the molecular formula C15H24ClN3S
and a molecular weight of 313.90 g/mol. Its IUPAC name is 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-pentylsulfanylpyrazine;hydrochloride.
Molecular Properties
| Compound Name | 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-pentylsulfanylpyrazine;hydrochloride |
| PubChem CID | 19800174 |
| Molecular Formula | C15H24ClN3S |
| Molecular Weight | 313.90 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-pentylsulfanylpyrazine;hydrochloride |
| SMILES | CCCCCSc1nccnc1C1=CCCN(C)C1.Cl |
| InChI | InChI=1S/C15H23N3S.ClH/c1-3-4-5-11-19-15-14(16-8-9-17-15)13-7-6-10-18(2)12-13;/h7-9H,3-6,10-12H2,1-2H3;1H |
| InChIKey | VLVSFBVSEMSLHV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.90 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-pentylsulfanylpyrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-pentylsulfanylpyrazine;hydrochloride?
The IUPAC name of 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-pentylsulfanylpyrazine;hydrochloride (CID 19800174) is 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-pentylsulfanylpyrazine;hydrochloride.
What is the SMILES notation for 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-pentylsulfanylpyrazine;hydrochloride?
The canonical SMILES for 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-pentylsulfanylpyrazine;hydrochloride is CCCCCSc1nccnc1C1=CCCN(C)C1.Cl.
What is the InChIKey of 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-pentylsulfanylpyrazine;hydrochloride?
The InChIKey is VLVSFBVSEMSLHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3S.ClH/c1-3-4-5-11-19-15-14(16-8-9-17-15)13-7-6-10-18(2)12-13;/h7-9H,3-6,10-12H2,1-2H3;1H.
What are the key properties of 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-pentylsulfanylpyrazine;hydrochloride?
2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-pentylsulfanylpyrazine;hydrochloride has a molecular weight of 313.90 g/mol, XLogP of 3.90, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-pentylsulfanylpyrazine;hydrochloride is sourced from PubChem (CID 19800174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).