About 3-chloro-9H-fluorene
3-chloro-9H-fluorene (PubChem CID 19800356) has the molecular formula C13H9Cl
and a molecular weight of 200.67 g/mol. Its IUPAC name is 3-chloro-9H-fluorene.
Molecular Properties
| Compound Name | 3-chloro-9H-fluorene |
| PubChem CID | 19800356 |
| Molecular Formula | C13H9Cl |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 3-chloro-9H-fluorene |
| SMILES | Clc1ccc2c(c1)-c1ccccc1C2 |
| InChI | InChI=1S/C13H9Cl/c14-11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11/h1-6,8H,7H2 |
| InChIKey | IKCMKJPFGUEKHR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-chloro-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-9H-fluorene?
The IUPAC name of 3-chloro-9H-fluorene (CID 19800356) is 3-chloro-9H-fluorene.
What is the SMILES notation for 3-chloro-9H-fluorene?
The canonical SMILES for 3-chloro-9H-fluorene is Clc1ccc2c(c1)-c1ccccc1C2.
What is the InChIKey of 3-chloro-9H-fluorene?
The InChIKey is IKCMKJPFGUEKHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl/c14-11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11/h1-6,8H,7H2.
What are the key properties of 3-chloro-9H-fluorene?
3-chloro-9H-fluorene has a molecular weight of 200.67 g/mol, XLogP of 3.91, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-9H-fluorene is sourced from PubChem (CID 19800356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).