C17H26N2O7 — CID 19800385
3-[2,3-bis(oxiran-2-ylmethoxy)propyl]-5,5-dimethyl-1-(oxiran-2-ylmethyl)imidazolidine-2,4-dione (PubChem CID 19800385) has the molecular formula C17H26N2O7 and a molecular weight of 370.40 g/mol. Its IUPAC name is 3-[2,3-bis(oxiran-2-ylmethoxy)propyl]-5,5-dimethyl-1-(oxiran-2-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2,3-bis(oxiran-2-ylmethoxy)propyl]-5,5-dimethyl-1-(oxiran-2-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 19800385 |
| Molecular Formula | C17H26N2O7 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 3-[2,3-bis(oxiran-2-ylmethoxy)propyl]-5,5-dimethyl-1-(oxiran-2-ylmethyl)imidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N(CC(COCC2CO2)OCC2CO2)C(=O)N1CC1CO1 |
| InChI | InChI=1S/C17H26N2O7/c1-17(2)15(20)18(16(21)19(17)4-12-7-23-12)3-11(24-9-14-10-26-14)5-22-6-13-8-25-13/h11-14H,3-10H2,1-2H3 |
| InChIKey | DWMZRAVBTUWZKE-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 96.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|