C10H10BrClFNO2S — CID 19800622
2-(5-amino-2-chloro-4-fluorophenyl)sulfanyl-4-bromobutanoic acid (PubChem CID 19800622) has the molecular formula C10H10BrClFNO2S and a molecular weight of 342.62 g/mol. Its IUPAC name is 2-(5-amino-2-chloro-4-fluorophenyl)sulfanyl-4-bromobutanoic acid.
| Compound Name | 2-(5-amino-2-chloro-4-fluorophenyl)sulfanyl-4-bromobutanoic acid |
|---|---|
| PubChem CID | 19800622 |
| Molecular Formula | C10H10BrClFNO2S |
| Molecular Weight | 342.62 g/mol |
| Exact Mass | 340.93 |
| IUPAC Name | 2-(5-amino-2-chloro-4-fluorophenyl)sulfanyl-4-bromobutanoic acid |
| SMILES | Nc1cc(SC(CCBr)C(=O)O)c(Cl)cc1F |
| InChI | InChI=1S/C10H10BrClFNO2S/c11-2-1-8(10(15)16)17-9-4-7(14)6(13)3-5(9)12/h3-4,8H,1-2,14H2,(H,15,16) |
| InChIKey | DABWTQWMSHBHPW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.62 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|