About 2-hydroxypropanoyl decanoate
2-hydroxypropanoyl decanoate (PubChem CID 19800829) has the molecular formula C13H24O4
and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-hydroxypropanoyl decanoate.
Molecular Properties
| Compound Name | 2-hydroxypropanoyl decanoate |
| PubChem CID | 19800829 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 2-hydroxypropanoyl decanoate |
| SMILES | CCCCCCCCCC(=O)OC(=O)C(C)O |
| InChI | InChI=1S/C13H24O4/c1-3-4-5-6-7-8-9-10-12(15)17-13(16)11(2)14/h11,14H,3-10H2,1-2H3 |
| InChIKey | YXODKKVHIVZPFO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropanoyl decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanoyl decanoate?
The IUPAC name of 2-hydroxypropanoyl decanoate (CID 19800829) is 2-hydroxypropanoyl decanoate.
What is the SMILES notation for 2-hydroxypropanoyl decanoate?
The canonical SMILES for 2-hydroxypropanoyl decanoate is CCCCCCCCCC(=O)OC(=O)C(C)O.
What is the InChIKey of 2-hydroxypropanoyl decanoate?
The InChIKey is YXODKKVHIVZPFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O4/c1-3-4-5-6-7-8-9-10-12(15)17-13(16)11(2)14/h11,14H,3-10H2,1-2H3.
What are the key properties of 2-hydroxypropanoyl decanoate?
2-hydroxypropanoyl decanoate has a molecular weight of 244.33 g/mol, XLogP of 2.58, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanoyl decanoate is sourced from PubChem (CID 19800829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).