About di(cyclohexa-2,4-dien-1-yl)diazene
di(cyclohexa-2,4-dien-1-yl)diazene (PubChem CID 19800876) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is di(cyclohexa-2,4-dien-1-yl)diazene.
Molecular Properties
| Compound Name | di(cyclohexa-2,4-dien-1-yl)diazene |
| PubChem CID | 19800876 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | di(cyclohexa-2,4-dien-1-yl)diazene |
| SMILES | C1=CCC(/N=N/C2C=CC=CC2)C=C1 |
| InChI | InChI=1S/C12H14N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-7,9,11-12H,8,10H2/b14-13+ |
| InChIKey | XLJIYHKBBIFSHT-BUHFOSPRSA-N |
| XLogP | 3.21 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze di(cyclohexa-2,4-dien-1-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(cyclohexa-2,4-dien-1-yl)diazene?
The IUPAC name of di(cyclohexa-2,4-dien-1-yl)diazene (CID 19800876) is di(cyclohexa-2,4-dien-1-yl)diazene.
What is the SMILES notation for di(cyclohexa-2,4-dien-1-yl)diazene?
The canonical SMILES for di(cyclohexa-2,4-dien-1-yl)diazene is C1=CCC(/N=N/C2C=CC=CC2)C=C1.
What is the InChIKey of di(cyclohexa-2,4-dien-1-yl)diazene?
The InChIKey is XLJIYHKBBIFSHT-BUHFOSPRSA-N. The full InChI is InChI=1S/C12H14N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-7,9,11-12H,8,10H2/b14-13+.
What are the key properties of di(cyclohexa-2,4-dien-1-yl)diazene?
di(cyclohexa-2,4-dien-1-yl)diazene has a molecular weight of 186.26 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for di(cyclohexa-2,4-dien-1-yl)diazene is sourced from PubChem (CID 19800876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).