About 5-(1,3-dithian-2-yl)-1-methylimidazole
5-(1,3-dithian-2-yl)-1-methylimidazole (PubChem CID 19801340) has the molecular formula C8H12N2S2
and a molecular weight of 200.33 g/mol. Its IUPAC name is 5-(1,3-dithian-2-yl)-1-methylimidazole.
Molecular Properties
| Compound Name | 5-(1,3-dithian-2-yl)-1-methylimidazole |
| PubChem CID | 19801340 |
| Molecular Formula | C8H12N2S2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 5-(1,3-dithian-2-yl)-1-methylimidazole |
| SMILES | Cn1cncc1C1SCCCS1 |
| InChI | InChI=1S/C8H12N2S2/c1-10-6-9-5-7(10)8-11-3-2-4-12-8/h5-6,8H,2-4H2,1H3 |
| InChIKey | QGLPHLVMGILNIG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,3-dithian-2-yl)-1-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dithian-2-yl)-1-methylimidazole?
The IUPAC name of 5-(1,3-dithian-2-yl)-1-methylimidazole (CID 19801340) is 5-(1,3-dithian-2-yl)-1-methylimidazole.
What is the SMILES notation for 5-(1,3-dithian-2-yl)-1-methylimidazole?
The canonical SMILES for 5-(1,3-dithian-2-yl)-1-methylimidazole is Cn1cncc1C1SCCCS1.
What is the InChIKey of 5-(1,3-dithian-2-yl)-1-methylimidazole?
The InChIKey is QGLPHLVMGILNIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S2/c1-10-6-9-5-7(10)8-11-3-2-4-12-8/h5-6,8H,2-4H2,1H3.
What are the key properties of 5-(1,3-dithian-2-yl)-1-methylimidazole?
5-(1,3-dithian-2-yl)-1-methylimidazole has a molecular weight of 200.33 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dithian-2-yl)-1-methylimidazole is sourced from PubChem (CID 19801340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).