About ethyl (2-oxo-1,2-diphenylethyl) carbonate
ethyl (2-oxo-1,2-diphenylethyl) carbonate (PubChem CID 19801564) has the molecular formula C17H16O4
and a molecular weight of 284.31 g/mol. Its IUPAC name is ethyl (2-oxo-1,2-diphenylethyl) carbonate.
Molecular Properties
| Compound Name | ethyl (2-oxo-1,2-diphenylethyl) carbonate |
| PubChem CID | 19801564 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | ethyl (2-oxo-1,2-diphenylethyl) carbonate |
| SMILES | CCOC(=O)OC(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16O4/c1-2-20-17(19)21-16(14-11-7-4-8-12-14)15(18)13-9-5-3-6-10-13/h3-12,16H,2H2,1H3 |
| InChIKey | VFXDOHNVYZZSHS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (2-oxo-1,2-diphenylethyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2-oxo-1,2-diphenylethyl) carbonate?
The IUPAC name of ethyl (2-oxo-1,2-diphenylethyl) carbonate (CID 19801564) is ethyl (2-oxo-1,2-diphenylethyl) carbonate.
What is the SMILES notation for ethyl (2-oxo-1,2-diphenylethyl) carbonate?
The canonical SMILES for ethyl (2-oxo-1,2-diphenylethyl) carbonate is CCOC(=O)OC(C(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl (2-oxo-1,2-diphenylethyl) carbonate?
The InChIKey is VFXDOHNVYZZSHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O4/c1-2-20-17(19)21-16(14-11-7-4-8-12-14)15(18)13-9-5-3-6-10-13/h3-12,16H,2H2,1H3.
What are the key properties of ethyl (2-oxo-1,2-diphenylethyl) carbonate?
ethyl (2-oxo-1,2-diphenylethyl) carbonate has a molecular weight of 284.31 g/mol, XLogP of 3.78, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2-oxo-1,2-diphenylethyl) carbonate is sourced from PubChem (CID 19801564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).