C16H21NO6 — CID 19802625
3-(4-methoxyphenyl)-1-azabicyclo[2.2.2]octan-3-ol;oxalic acid (PubChem CID 19802625) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-azabicyclo[2.2.2]octan-3-ol;oxalic acid.
| Compound Name | 3-(4-methoxyphenyl)-1-azabicyclo[2.2.2]octan-3-ol;oxalic acid |
|---|---|
| PubChem CID | 19802625 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-azabicyclo[2.2.2]octan-3-ol;oxalic acid |
| SMILES | COc1ccc(C2(O)CN3CCC2CC3)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H19NO2.C2H2O4/c1-17-13-4-2-11(3-5-13)14(16)10-15-8-6-12(14)7-9-15;3-1(4)2(5)6/h2-5,12,16H,6-10H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | UWFPZPIZZYBION-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|