C12H16N4O3S2 — CID 19802678
(2E)-5-(hydroxymethyl)-2-[(E)-(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]-3-(2-methylprop-2-enyl)-1,3-thiazolidin-4-one (PubChem CID 19802678) has the molecular formula C12H16N4O3S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (2E)-5-(hydroxymethyl)-2-[(E)-(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]-3-(2-methylprop-2-enyl)-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-(hydroxymethyl)-2-[(E)-(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]-3-(2-methylprop-2-enyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 19802678 |
| Molecular Formula | C12H16N4O3S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (2E)-5-(hydroxymethyl)-2-[(E)-(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]-3-(2-methylprop-2-enyl)-1,3-thiazolidin-4-one |
| SMILES | C=C(C)CN1C(=O)C(CO)S/C1=N/N=C1/SCC(=O)N1C |
| InChI | InChI=1S/C12H16N4O3S2/c1-7(2)4-16-10(19)8(5-17)21-12(16)14-13-11-15(3)9(18)6-20-11/h8,17H,1,4-6H2,2-3H3/b13-11+,14-12+ |
| InChIKey | LTTFQDYBICLTLJ-PHEQNACWSA-N |
| XLogP | 0.33 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|