C18H32O2 — CID 19803375
5-butan-2-yl-5-methyl-2-(3,5,6-trimethylcyclohex-3-en-1-yl)-1,3-dioxane (PubChem CID 19803375) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 5-butan-2-yl-5-methyl-2-(3,5,6-trimethylcyclohex-3-en-1-yl)-1,3-dioxane.
| Compound Name | 5-butan-2-yl-5-methyl-2-(3,5,6-trimethylcyclohex-3-en-1-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 19803375 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 5-butan-2-yl-5-methyl-2-(3,5,6-trimethylcyclohex-3-en-1-yl)-1,3-dioxane |
| SMILES | CCC(C)C1(C)COC(C2CC(C)=CC(C)C2C)OC1 |
| InChI | InChI=1S/C18H32O2/c1-7-14(4)18(6)10-19-17(20-11-18)16-9-12(2)8-13(3)15(16)5/h8,13-17H,7,9-11H2,1-6H3 |
| InChIKey | WLVQFLZUIVDYOF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|