About 7,8-dimethyl-1,3-dihydro-1-benzazepin-2-one
7,8-dimethyl-1,3-dihydro-1-benzazepin-2-one (PubChem CID 19804193) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 7,8-dimethyl-1,3-dihydro-1-benzazepin-2-one.
Molecular Properties
| Compound Name | 7,8-dimethyl-1,3-dihydro-1-benzazepin-2-one |
| PubChem CID | 19804193 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 7,8-dimethyl-1,3-dihydro-1-benzazepin-2-one |
| SMILES | Cc1cc2c(cc1C)NC(=O)CC=C2 |
| InChI | InChI=1S/C12H13NO/c1-8-6-10-4-3-5-12(14)13-11(10)7-9(8)2/h3-4,6-7H,5H2,1-2H3,(H,13,14) |
| InChIKey | HCLQHMWNRYJAOD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7,8-dimethyl-1,3-dihydro-1-benzazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethyl-1,3-dihydro-1-benzazepin-2-one?
The IUPAC name of 7,8-dimethyl-1,3-dihydro-1-benzazepin-2-one (CID 19804193) is 7,8-dimethyl-1,3-dihydro-1-benzazepin-2-one.
What is the SMILES notation for 7,8-dimethyl-1,3-dihydro-1-benzazepin-2-one?
The canonical SMILES for 7,8-dimethyl-1,3-dihydro-1-benzazepin-2-one is Cc1cc2c(cc1C)NC(=O)CC=C2.
What is the InChIKey of 7,8-dimethyl-1,3-dihydro-1-benzazepin-2-one?
The InChIKey is HCLQHMWNRYJAOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO/c1-8-6-10-4-3-5-12(14)13-11(10)7-9(8)2/h3-4,6-7H,5H2,1-2H3,(H,13,14).
What are the key properties of 7,8-dimethyl-1,3-dihydro-1-benzazepin-2-one?
7,8-dimethyl-1,3-dihydro-1-benzazepin-2-one has a molecular weight of 187.24 g/mol, XLogP of 2.66, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethyl-1,3-dihydro-1-benzazepin-2-one is sourced from PubChem (CID 19804193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).