About (Z)-1,2-dichloro-3-(chloromethyl)-4,4-dimethylpent-1-en-3-ol
(Z)-1,2-dichloro-3-(chloromethyl)-4,4-dimethylpent-1-en-3-ol (PubChem CID 19804303) has the molecular formula C8H13Cl3O
and a molecular weight of 231.55 g/mol. Its IUPAC name is (Z)-1,2-dichloro-3-(chloromethyl)-4,4-dimethylpent-1-en-3-ol.
Molecular Properties
| Compound Name | (Z)-1,2-dichloro-3-(chloromethyl)-4,4-dimethylpent-1-en-3-ol |
| PubChem CID | 19804303 |
| Molecular Formula | C8H13Cl3O |
| Molecular Weight | 231.55 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | (Z)-1,2-dichloro-3-(chloromethyl)-4,4-dimethylpent-1-en-3-ol |
| SMILES | CC(C)(C)C(O)(CCl)/C(Cl)=C/Cl |
| InChI | InChI=1S/C8H13Cl3O/c1-7(2,3)8(12,5-10)6(11)4-9/h4,12H,5H2,1-3H3/b6-4- |
| InChIKey | COMDBCXPUKKLCV-XQRVVYSFSA-N |
| XLogP | 3.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,2-dichloro-3-(chloromethyl)-4,4-dimethylpent-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,2-dichloro-3-(chloromethyl)-4,4-dimethylpent-1-en-3-ol?
The IUPAC name of (Z)-1,2-dichloro-3-(chloromethyl)-4,4-dimethylpent-1-en-3-ol (CID 19804303) is (Z)-1,2-dichloro-3-(chloromethyl)-4,4-dimethylpent-1-en-3-ol.
What is the SMILES notation for (Z)-1,2-dichloro-3-(chloromethyl)-4,4-dimethylpent-1-en-3-ol?
The canonical SMILES for (Z)-1,2-dichloro-3-(chloromethyl)-4,4-dimethylpent-1-en-3-ol is CC(C)(C)C(O)(CCl)/C(Cl)=C/Cl.
What is the InChIKey of (Z)-1,2-dichloro-3-(chloromethyl)-4,4-dimethylpent-1-en-3-ol?
The InChIKey is COMDBCXPUKKLCV-XQRVVYSFSA-N. The full InChI is InChI=1S/C8H13Cl3O/c1-7(2,3)8(12,5-10)6(11)4-9/h4,12H,5H2,1-3H3/b6-4-.
What are the key properties of (Z)-1,2-dichloro-3-(chloromethyl)-4,4-dimethylpent-1-en-3-ol?
(Z)-1,2-dichloro-3-(chloromethyl)-4,4-dimethylpent-1-en-3-ol has a molecular weight of 231.55 g/mol, XLogP of 3.32, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,2-dichloro-3-(chloromethyl)-4,4-dimethylpent-1-en-3-ol is sourced from PubChem (CID 19804303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).