About 4-hept-6-ynoxy-3,5-dimethylbenzonitrile
4-hept-6-ynoxy-3,5-dimethylbenzonitrile (PubChem CID 19804371) has the molecular formula C16H19NO
and a molecular weight of 241.33 g/mol. Its IUPAC name is 4-hept-6-ynoxy-3,5-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 4-hept-6-ynoxy-3,5-dimethylbenzonitrile |
| PubChem CID | 19804371 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 4-hept-6-ynoxy-3,5-dimethylbenzonitrile |
| SMILES | C#CCCCCCOc1c(C)cc(C#N)cc1C |
| InChI | InChI=1S/C16H19NO/c1-4-5-6-7-8-9-18-16-13(2)10-15(12-17)11-14(16)3/h1,10-11H,5-9H2,2-3H3 |
| InChIKey | FEPKFDKBWCQDDN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hept-6-ynoxy-3,5-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hept-6-ynoxy-3,5-dimethylbenzonitrile?
The IUPAC name of 4-hept-6-ynoxy-3,5-dimethylbenzonitrile (CID 19804371) is 4-hept-6-ynoxy-3,5-dimethylbenzonitrile.
What is the SMILES notation for 4-hept-6-ynoxy-3,5-dimethylbenzonitrile?
The canonical SMILES for 4-hept-6-ynoxy-3,5-dimethylbenzonitrile is C#CCCCCCOc1c(C)cc(C#N)cc1C.
What is the InChIKey of 4-hept-6-ynoxy-3,5-dimethylbenzonitrile?
The InChIKey is FEPKFDKBWCQDDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO/c1-4-5-6-7-8-9-18-16-13(2)10-15(12-17)11-14(16)3/h1,10-11H,5-9H2,2-3H3.
What are the key properties of 4-hept-6-ynoxy-3,5-dimethylbenzonitrile?
4-hept-6-ynoxy-3,5-dimethylbenzonitrile has a molecular weight of 241.33 g/mol, XLogP of 3.75, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hept-6-ynoxy-3,5-dimethylbenzonitrile is sourced from PubChem (CID 19804371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).