C3H2Cl2F4O2 — CID 19804522
1,3-dichloro-1,1,3,3-tetrafluoropropan-2-one;hydrate (PubChem CID 19804522) has the molecular formula C3H2Cl2F4O2 and a molecular weight of 216.94 g/mol. Its IUPAC name is 1,3-dichloro-1,1,3,3-tetrafluoropropan-2-one;hydrate.
| Compound Name | 1,3-dichloro-1,1,3,3-tetrafluoropropan-2-one;hydrate |
|---|---|
| PubChem CID | 19804522 |
| Molecular Formula | C3H2Cl2F4O2 |
| Molecular Weight | 216.94 g/mol |
| Exact Mass | 215.94 |
| IUPAC Name | 1,3-dichloro-1,1,3,3-tetrafluoropropan-2-one;hydrate |
| SMILES | O.O=C(C(F)(F)Cl)C(F)(F)Cl |
| InChI | InChI=1S/C3Cl2F4O.H2O/c4-2(6,7)1(10)3(5,8)9;/h;1H2 |
| InChIKey | IBFMADKVGRNGDG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 48.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.94 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|