C13H12Cl2N4O4 — CID 19804632
5-[2-(2,6-dichloropurin-7-yl)ethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 19804632) has the molecular formula C13H12Cl2N4O4 and a molecular weight of 359.17 g/mol. Its IUPAC name is 5-[2-(2,6-dichloropurin-7-yl)ethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[2-(2,6-dichloropurin-7-yl)ethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 19804632 |
| Molecular Formula | C13H12Cl2N4O4 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 5-[2-(2,6-dichloropurin-7-yl)ethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(CCn2cnc3nc(Cl)nc(Cl)c32)C(=O)O1 |
| InChI | InChI=1S/C13H12Cl2N4O4/c1-13(2)22-10(20)6(11(21)23-13)3-4-19-5-16-9-7(19)8(14)17-12(15)18-9/h5-6H,3-4H2,1-2H3 |
| InChIKey | LMVKPPAQGAREEF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|