About [[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] benzoate
[[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] benzoate (PubChem CID 19804714) has the molecular formula C24H14F6N2O2
and a molecular weight of 476.38 g/mol. Its IUPAC name is [[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] benzoate.
Molecular Properties
| Compound Name | [[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] benzoate |
| PubChem CID | 19804714 |
| Molecular Formula | C24H14F6N2O2 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | [[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] benzoate |
| SMILES | O=C(OC(c1ccccn1)c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)c1ccccc1 |
| InChI | InChI=1S/C24H14F6N2O2/c25-23(26,27)17-10-6-9-15-16(13-19(24(28,29)30)32-20(15)17)21(18-11-4-5-12-31-18)34-22(33)14-7-2-1-3-8-14/h1-13,21H |
| InChIKey | WOABJWOXEGSOMT-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] benzoate?
The IUPAC name of [[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] benzoate (CID 19804714) is [[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] benzoate.
What is the SMILES notation for [[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] benzoate?
The canonical SMILES for [[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] benzoate is O=C(OC(c1ccccn1)c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)c1ccccc1.
What is the InChIKey of [[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] benzoate?
The InChIKey is WOABJWOXEGSOMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14F6N2O2/c25-23(26,27)17-10-6-9-15-16(13-19(24(28,29)30)32-20(15)17)21(18-11-4-5-12-31-18)34-22(33)14-7-2-1-3-8-14/h1-13,21H.
What are the key properties of [[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] benzoate?
[[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] benzoate has a molecular weight of 476.38 g/mol, XLogP of 6.61, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] benzoate is sourced from PubChem (CID 19804714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).