About bis[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethanol
bis[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethanol (PubChem CID 19804719) has the molecular formula C28H13F12N3O
and a molecular weight of 635.41 g/mol. Its IUPAC name is bis[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethanol.
Molecular Properties
| Compound Name | bis[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethanol |
| PubChem CID | 19804719 |
| Molecular Formula | C28H13F12N3O |
| Molecular Weight | 635.41 g/mol |
| Exact Mass | 635.09 |
| IUPAC Name | bis[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethanol |
| SMILES | OC(c1ccccn1)(c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C28H13F12N3O/c29-25(30,31)15-7-3-5-13-17(11-20(27(35,36)37)42-22(13)15)24(44,19-9-1-2-10-41-19)18-12-21(28(38,39)40)43-23-14(18)6-4-8-16(23)26(32,33)34/h1-12,44H |
| InChIKey | KENAZISZVRKIPH-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 635.41 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethanol?
The IUPAC name of bis[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethanol (CID 19804719) is bis[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethanol.
What is the SMILES notation for bis[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethanol?
The canonical SMILES for bis[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethanol is OC(c1ccccn1)(c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12.
What is the InChIKey of bis[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethanol?
The InChIKey is KENAZISZVRKIPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H13F12N3O/c29-25(30,31)15-7-3-5-13-17(11-20(27(35,36)37)42-22(13)15)24(44,19-9-1-2-10-41-19)18-12-21(28(38,39)40)43-23-14(18)6-4-8-16(23)26(32,33)34/h1-12,44H.
What are the key properties of bis[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethanol?
bis[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethanol has a molecular weight of 635.41 g/mol, XLogP of 8.54, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2,8-bis(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethanol is sourced from PubChem (CID 19804719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).