About [3-pyridin-2-yl-2,8-bis(trifluoromethyl)quinolin-4-yl]methyl acetate
[3-pyridin-2-yl-2,8-bis(trifluoromethyl)quinolin-4-yl]methyl acetate (PubChem CID 19804720) has the molecular formula C19H12F6N2O2
and a molecular weight of 414.31 g/mol. Its IUPAC name is [3-pyridin-2-yl-2,8-bis(trifluoromethyl)quinolin-4-yl]methyl acetate.
Molecular Properties
| Compound Name | [3-pyridin-2-yl-2,8-bis(trifluoromethyl)quinolin-4-yl]methyl acetate |
| PubChem CID | 19804720 |
| Molecular Formula | C19H12F6N2O2 |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | [3-pyridin-2-yl-2,8-bis(trifluoromethyl)quinolin-4-yl]methyl acetate |
| SMILES | CC(=O)OCc1c(-c2ccccn2)c(C(F)(F)F)nc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C19H12F6N2O2/c1-10(28)29-9-12-11-5-4-6-13(18(20,21)22)16(11)27-17(19(23,24)25)15(12)14-7-2-3-8-26-14/h2-8H,9H2,1H3 |
| InChIKey | RHXLVUYCGZZIPH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-pyridin-2-yl-2,8-bis(trifluoromethyl)quinolin-4-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-pyridin-2-yl-2,8-bis(trifluoromethyl)quinolin-4-yl]methyl acetate?
The IUPAC name of [3-pyridin-2-yl-2,8-bis(trifluoromethyl)quinolin-4-yl]methyl acetate (CID 19804720) is [3-pyridin-2-yl-2,8-bis(trifluoromethyl)quinolin-4-yl]methyl acetate.
What is the SMILES notation for [3-pyridin-2-yl-2,8-bis(trifluoromethyl)quinolin-4-yl]methyl acetate?
The canonical SMILES for [3-pyridin-2-yl-2,8-bis(trifluoromethyl)quinolin-4-yl]methyl acetate is CC(=O)OCc1c(-c2ccccn2)c(C(F)(F)F)nc2c(C(F)(F)F)cccc12.
What is the InChIKey of [3-pyridin-2-yl-2,8-bis(trifluoromethyl)quinolin-4-yl]methyl acetate?
The InChIKey is RHXLVUYCGZZIPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F6N2O2/c1-10(28)29-9-12-11-5-4-6-13(18(20,21)22)16(11)27-17(19(23,24)25)15(12)14-7-2-3-8-26-14/h2-8H,9H2,1H3.
What are the key properties of [3-pyridin-2-yl-2,8-bis(trifluoromethyl)quinolin-4-yl]methyl acetate?
[3-pyridin-2-yl-2,8-bis(trifluoromethyl)quinolin-4-yl]methyl acetate has a molecular weight of 414.31 g/mol, XLogP of 5.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-pyridin-2-yl-2,8-bis(trifluoromethyl)quinolin-4-yl]methyl acetate is sourced from PubChem (CID 19804720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).