About 2-(benzenesulfonyl)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethanol
2-(benzenesulfonyl)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethanol (PubChem CID 19804779) has the molecular formula C13H13F2NO3S
and a molecular weight of 301.31 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethanol |
| PubChem CID | 19804779 |
| Molecular Formula | C13H13F2NO3S |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-(benzenesulfonyl)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethanol |
| SMILES | Cn1cccc1C(O)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H13F2NO3S/c1-16-9-5-8-11(16)12(17)13(14,15)20(18,19)10-6-3-2-4-7-10/h2-9,12,17H,1H3 |
| InChIKey | SWPBGCNZYOTSHG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(benzenesulfonyl)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethanol?
The IUPAC name of 2-(benzenesulfonyl)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethanol (CID 19804779) is 2-(benzenesulfonyl)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethanol.
What is the SMILES notation for 2-(benzenesulfonyl)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethanol?
The canonical SMILES for 2-(benzenesulfonyl)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethanol is Cn1cccc1C(O)C(F)(F)S(=O)(=O)c1ccccc1.
What is the InChIKey of 2-(benzenesulfonyl)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethanol?
The InChIKey is SWPBGCNZYOTSHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F2NO3S/c1-16-9-5-8-11(16)12(17)13(14,15)20(18,19)10-6-3-2-4-7-10/h2-9,12,17H,1H3.
What are the key properties of 2-(benzenesulfonyl)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethanol?
2-(benzenesulfonyl)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethanol has a molecular weight of 301.31 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethanol is sourced from PubChem (CID 19804779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).