C14H2F12O3S — CID 19804803
2,2-difluoro-1-(2,3,4,5,6-pentafluorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfonylethanol (PubChem CID 19804803) has the molecular formula C14H2F12O3S and a molecular weight of 478.21 g/mol. Its IUPAC name is 2,2-difluoro-1-(2,3,4,5,6-pentafluorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfonylethanol.
| Compound Name | 2,2-difluoro-1-(2,3,4,5,6-pentafluorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfonylethanol |
|---|---|
| PubChem CID | 19804803 |
| Molecular Formula | C14H2F12O3S |
| Molecular Weight | 478.21 g/mol |
| Exact Mass | 477.95 |
| IUPAC Name | 2,2-difluoro-1-(2,3,4,5,6-pentafluorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfonylethanol |
| SMILES | O=S(=O)(c1c(F)c(F)c(F)c(F)c1F)C(F)(F)C(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H2F12O3S/c15-2-1(3(16)5(18)6(19)4(2)17)13(27)14(25,26)30(28,29)12-10(23)8(21)7(20)9(22)11(12)24/h13,27H |
| InChIKey | RVNHRNWCTLOIGM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.21 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|