C11H19N7S2 — CID 19805204
6-[bis(prop-2-enyl)amino]-1H-1,3,5-triazine-2,4-dithione;ethene-1,1,2-triamine (PubChem CID 19805204) has the molecular formula C11H19N7S2 and a molecular weight of 313.46 g/mol. Its IUPAC name is 6-[bis(prop-2-enyl)amino]-1H-1,3,5-triazine-2,4-dithione;ethene-1,1,2-triamine.
| Compound Name | 6-[bis(prop-2-enyl)amino]-1H-1,3,5-triazine-2,4-dithione;ethene-1,1,2-triamine |
|---|---|
| PubChem CID | 19805204 |
| Molecular Formula | C11H19N7S2 |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 6-[bis(prop-2-enyl)amino]-1H-1,3,5-triazine-2,4-dithione;ethene-1,1,2-triamine |
| SMILES | C=CCN(CC=C)c1nc(=S)[nH]c(=S)[nH]1.NC=C(N)N |
| InChI | InChI=1S/C9H12N4S2.C2H7N3/c1-3-5-13(6-4-2)7-10-8(14)12-9(15)11-7;3-1-2(4)5/h3-4H,1-2,5-6H2,(H2,10,11,12,14,15);1H,3-5H2 |
| InChIKey | IWFXQAAUDTZJCI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 125.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|