C13H27N5OS2 — CID 19805210
2-aminoethanol;6-(dibutylamino)-1H-1,3,5-triazine-2,4-dithione (PubChem CID 19805210) has the molecular formula C13H27N5OS2 and a molecular weight of 333.53 g/mol. Its IUPAC name is 2-aminoethanol;6-(dibutylamino)-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 2-aminoethanol;6-(dibutylamino)-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 19805210 |
| Molecular Formula | C13H27N5OS2 |
| Molecular Weight | 333.53 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-aminoethanol;6-(dibutylamino)-1H-1,3,5-triazine-2,4-dithione |
| SMILES | CCCCN(CCCC)c1nc(=S)[nH]c(=S)[nH]1.NCCO |
| InChI | InChI=1S/C11H20N4S2.C2H7NO/c1-3-5-7-15(8-6-4-2)9-12-10(16)14-11(17)13-9;3-1-2-4/h3-8H2,1-2H3,(H2,12,13,14,16,17);4H,1-3H2 |
| InChIKey | RRXHYVHRHDYHDA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|