C10H17CrN3O6 — CID 19805253
4-diazo-3,6-dimethoxy-N,N-dimethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium (PubChem CID 19805253) has the molecular formula C10H17CrN3O6 and a molecular weight of 327.26 g/mol. Its IUPAC name is 4-diazo-3,6-dimethoxy-N,N-dimethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium.
| Compound Name | 4-diazo-3,6-dimethoxy-N,N-dimethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium |
|---|---|
| PubChem CID | 19805253 |
| Molecular Formula | C10H17CrN3O6 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 4-diazo-3,6-dimethoxy-N,N-dimethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium |
| SMILES | COC1=CC(=[N+]=[N-])C(OC)C=C1N(C)C.O=[Cr](=O)(O)O |
| InChI | InChI=1S/C10H15N3O2.Cr.2H2O.2O/c1-13(2)8-6-9(14-3)7(12-11)5-10(8)15-4;;;;;/h5-6,9H,1-4H3;;2*1H2;;/q;+2;;;;/p-2 |
| InChIKey | YJOXHHJJGTVUFX-UHFFFAOYSA-L |
| XLogP | -0.69 |
| TPSA | 132.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|