C10H15N3 — CID 19805258
4-diazo-N,N,3,6-tetramethylcyclohexa-1,5-dien-1-amine (PubChem CID 19805258) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-diazo-N,N,3,6-tetramethylcyclohexa-1,5-dien-1-amine.
| Compound Name | 4-diazo-N,N,3,6-tetramethylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 19805258 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 4-diazo-N,N,3,6-tetramethylcyclohexa-1,5-dien-1-amine |
| SMILES | CC1=CC(=[N+]=[N-])C(C)C=C1N(C)C |
| InChI | InChI=1S/C10H15N3/c1-7-6-10(13(3)4)8(2)5-9(7)12-11/h5-7H,1-4H3 |
| InChIKey | ROVDZZWJWPXHFW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 39.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|