About 4-diazo-N,N-diethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium
4-diazo-N,N-diethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium (PubChem CID 19805263) has the molecular formula C10H17CrN3O4
and a molecular weight of 295.26 g/mol. Its IUPAC name is 4-diazo-N,N-diethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium.
Molecular Properties
| Compound Name | 4-diazo-N,N-diethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium |
| PubChem CID | 19805263 |
| Molecular Formula | C10H17CrN3O4 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 4-diazo-N,N-diethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium |
| SMILES | CCN(CC)C1=CCC(=[N+]=[N-])C=C1.O=[Cr](=O)(O)O |
| InChI | InChI=1S/C10H15N3.Cr.2H2O.2O/c1-3-13(4-2)10-7-5-9(12-11)6-8-10;;;;;/h5,7-8H,3-4,6H2,1-2H3;;2*1H2;;/q;+2;;;;/p-2 |
| InChIKey | ARQXUABHIOHRBC-UHFFFAOYSA-L |
| XLogP | 0.49 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-diazo-N,N-diethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazo-N,N-diethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium?
The IUPAC name of 4-diazo-N,N-diethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium (CID 19805263) is 4-diazo-N,N-diethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium.
What is the SMILES notation for 4-diazo-N,N-diethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium?
The canonical SMILES for 4-diazo-N,N-diethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium is CCN(CC)C1=CCC(=[N+]=[N-])C=C1.O=[Cr](=O)(O)O.
What is the InChIKey of 4-diazo-N,N-diethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium?
The InChIKey is ARQXUABHIOHRBC-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H15N3.Cr.2H2O.2O/c1-3-13(4-2)10-7-5-9(12-11)6-8-10;;;;;/h5,7-8H,3-4,6H2,1-2H3;;2*1H2;;/q;+2;;;;/p-2.
What are the key properties of 4-diazo-N,N-diethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium?
4-diazo-N,N-diethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium has a molecular weight of 295.26 g/mol, XLogP of 0.49, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazo-N,N-diethylcyclohexa-1,5-dien-1-amine;dihydroxy(dioxo)chromium is sourced from PubChem (CID 19805263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).