About 7-hydroxy-4H-4,7-phenanthrolin-5-ol
7-hydroxy-4H-4,7-phenanthrolin-5-ol (PubChem CID 19805354) has the molecular formula C12H10N2O2
and a molecular weight of 214.22 g/mol. Its IUPAC name is 7-hydroxy-4H-4,7-phenanthrolin-5-ol.
Molecular Properties
| Compound Name | 7-hydroxy-4H-4,7-phenanthrolin-5-ol |
| PubChem CID | 19805354 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 7-hydroxy-4H-4,7-phenanthrolin-5-ol |
| SMILES | Oc1cc2c(c3c1NC=CC=3)=CC=CN2O |
| InChI | InChI=1S/C12H10N2O2/c15-11-7-10-8(4-2-6-14(10)16)9-3-1-5-13-12(9)11/h1-7,13,15-16H |
| InChIKey | VGGSAKYYVASWAR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-4H-4,7-phenanthrolin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-4H-4,7-phenanthrolin-5-ol?
The IUPAC name of 7-hydroxy-4H-4,7-phenanthrolin-5-ol (CID 19805354) is 7-hydroxy-4H-4,7-phenanthrolin-5-ol.
What is the SMILES notation for 7-hydroxy-4H-4,7-phenanthrolin-5-ol?
The canonical SMILES for 7-hydroxy-4H-4,7-phenanthrolin-5-ol is Oc1cc2c(c3c1NC=CC=3)=CC=CN2O.
What is the InChIKey of 7-hydroxy-4H-4,7-phenanthrolin-5-ol?
The InChIKey is VGGSAKYYVASWAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2/c15-11-7-10-8(4-2-6-14(10)16)9-3-1-5-13-12(9)11/h1-7,13,15-16H.
What are the key properties of 7-hydroxy-4H-4,7-phenanthrolin-5-ol?
7-hydroxy-4H-4,7-phenanthrolin-5-ol has a molecular weight of 214.22 g/mol, XLogP of 0.62, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-4H-4,7-phenanthrolin-5-ol is sourced from PubChem (CID 19805354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).