About hydrogen sulfite;hydrate
hydrogen sulfite;hydrate (PubChem CID 19805598) has the molecular formula H3O4S-
and a molecular weight of 99.09 g/mol. Its IUPAC name is hydrogen sulfite;hydrate.
Molecular Properties
| Compound Name | hydrogen sulfite;hydrate |
| PubChem CID | 19805598 |
| Molecular Formula | H3O4S- |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 98.98 |
| IUPAC Name | hydrogen sulfite;hydrate |
| SMILES | O.O=S([O-])O |
| InChI | InChI=1S/H2O3S.H2O/c1-4(2)3;/h(H2,1,2,3);1H2/p-1 |
| InChIKey | GRNVJAJGRSXFFZ-UHFFFAOYSA-M |
| XLogP | -1.49 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze hydrogen sulfite;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen sulfite;hydrate?
The IUPAC name of hydrogen sulfite;hydrate (CID 19805598) is hydrogen sulfite;hydrate.
What is the SMILES notation for hydrogen sulfite;hydrate?
The canonical SMILES for hydrogen sulfite;hydrate is O.O=S([O-])O.
What is the InChIKey of hydrogen sulfite;hydrate?
The InChIKey is GRNVJAJGRSXFFZ-UHFFFAOYSA-M. The full InChI is InChI=1S/H2O3S.H2O/c1-4(2)3;/h(H2,1,2,3);1H2/p-1.
What are the key properties of hydrogen sulfite;hydrate?
hydrogen sulfite;hydrate has a molecular weight of 99.09 g/mol, XLogP of -1.49, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfite;hydrate is sourced from PubChem (CID 19805598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).