C9H8F9NO — CID 19805676
2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)morpholine (PubChem CID 19805676) has the molecular formula C9H8F9NO and a molecular weight of 317.15 g/mol. Its IUPAC name is 2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)morpholine.
| Compound Name | 2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)morpholine |
|---|---|
| PubChem CID | 19805676 |
| Molecular Formula | C9H8F9NO |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)morpholine |
| SMILES | FC1(F)C(F)(F)C(F)(F)C(F)(C2CNCCO2)C1(F)F |
| InChI | InChI=1S/C9H8F9NO/c10-5(4-3-19-1-2-20-4)6(11,12)8(15,16)9(17,18)7(5,13)14/h4,19H,1-3H2 |
| InChIKey | JSBRIDWIFSFIDT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|