C10H11F8NO — CID 19805677
4-cyclohexyl-2,2,3,3,5,5,6,6-octafluoromorpholine (PubChem CID 19805677) has the molecular formula C10H11F8NO and a molecular weight of 313.19 g/mol. Its IUPAC name is 4-cyclohexyl-2,2,3,3,5,5,6,6-octafluoromorpholine.
| Compound Name | 4-cyclohexyl-2,2,3,3,5,5,6,6-octafluoromorpholine |
|---|---|
| PubChem CID | 19805677 |
| Molecular Formula | C10H11F8NO |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-cyclohexyl-2,2,3,3,5,5,6,6-octafluoromorpholine |
| SMILES | FC1(F)OC(F)(F)C(F)(F)N(C2CCCCC2)C1(F)F |
| InChI | InChI=1S/C10H11F8NO/c11-7(12)9(15,16)20-10(17,18)8(13,14)19(7)6-4-2-1-3-5-6/h6H,1-5H2 |
| InChIKey | PXPWPVXYBXLTRP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|