About 4-[(2,4-diaminopteridin-6-yl)-methylamino]benzoic acid;trihydrate
4-[(2,4-diaminopteridin-6-yl)-methylamino]benzoic acid;trihydrate (PubChem CID 19805902) has the molecular formula C14H19N7O5
and a molecular weight of 365.35 g/mol. Its IUPAC name is 4-[(2,4-diaminopteridin-6-yl)-methylamino]benzoic acid;trihydrate.
Molecular Properties
| Compound Name | 4-[(2,4-diaminopteridin-6-yl)-methylamino]benzoic acid;trihydrate |
| PubChem CID | 19805902 |
| Molecular Formula | C14H19N7O5 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-[(2,4-diaminopteridin-6-yl)-methylamino]benzoic acid;trihydrate |
| SMILES | CN(c1ccc(C(=O)O)cc1)c1cnc2nc(N)nc(N)c2n1.O.O.O |
| InChI | InChI=1S/C14H13N7O2.3H2O/c1-21(8-4-2-7(3-5-8)13(22)23)9-6-17-12-10(18-9)11(15)19-14(16)20-12;;;/h2-6H,1H3,(H,22,23)(H4,15,16,17,19,20);3*1H2 |
| InChIKey | MMROCZRWTAMIJO-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 238.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[(2,4-diaminopteridin-6-yl)-methylamino]benzoic acid;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-diaminopteridin-6-yl)-methylamino]benzoic acid;trihydrate?
The IUPAC name of 4-[(2,4-diaminopteridin-6-yl)-methylamino]benzoic acid;trihydrate (CID 19805902) is 4-[(2,4-diaminopteridin-6-yl)-methylamino]benzoic acid;trihydrate.
What is the SMILES notation for 4-[(2,4-diaminopteridin-6-yl)-methylamino]benzoic acid;trihydrate?
The canonical SMILES for 4-[(2,4-diaminopteridin-6-yl)-methylamino]benzoic acid;trihydrate is CN(c1ccc(C(=O)O)cc1)c1cnc2nc(N)nc(N)c2n1.O.O.O.
What is the InChIKey of 4-[(2,4-diaminopteridin-6-yl)-methylamino]benzoic acid;trihydrate?
The InChIKey is MMROCZRWTAMIJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N7O2.3H2O/c1-21(8-4-2-7(3-5-8)13(22)23)9-6-17-12-10(18-9)11(15)19-14(16)20-12;;;/h2-6H,1H3,(H,22,23)(H4,15,16,17,19,20);3*1H2.
What are the key properties of 4-[(2,4-diaminopteridin-6-yl)-methylamino]benzoic acid;trihydrate?
4-[(2,4-diaminopteridin-6-yl)-methylamino]benzoic acid;trihydrate has a molecular weight of 365.35 g/mol, XLogP of -1.42, 3 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-diaminopteridin-6-yl)-methylamino]benzoic acid;trihydrate is sourced from PubChem (CID 19805902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).