C18H30N2O8 — CID 19806436
3-[[2-[bis(2-carboxyethyl)amino]cyclohexyl]-(2-carboxyethyl)amino]propanoic acid (PubChem CID 19806436) has the molecular formula C18H30N2O8 and a molecular weight of 402.44 g/mol. Its IUPAC name is 3-[[2-[bis(2-carboxyethyl)amino]cyclohexyl]-(2-carboxyethyl)amino]propanoic acid.
| Compound Name | 3-[[2-[bis(2-carboxyethyl)amino]cyclohexyl]-(2-carboxyethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 19806436 |
| Molecular Formula | C18H30N2O8 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 3-[[2-[bis(2-carboxyethyl)amino]cyclohexyl]-(2-carboxyethyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(CCC(=O)O)C1CCCCC1N(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C18H30N2O8/c21-15(22)5-9-19(10-6-16(23)24)13-3-1-2-4-14(13)20(11-7-17(25)26)12-8-18(27)28/h13-14H,1-12H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | IGBLJXZKUJYCKW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |