About pentane-1,3,5-trithiol
pentane-1,3,5-trithiol (PubChem CID 19807040) has the molecular formula C5H12S3
and a molecular weight of 168.35 g/mol. Its IUPAC name is pentane-1,3,5-trithiol.
Molecular Properties
| Compound Name | pentane-1,3,5-trithiol |
| PubChem CID | 19807040 |
| Molecular Formula | C5H12S3 |
| Molecular Weight | 168.35 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | pentane-1,3,5-trithiol |
| SMILES | SCCC(S)CCS |
| InChI | InChI=1S/C5H12S3/c6-3-1-5(8)2-4-7/h5-8H,1-4H2 |
| InChIKey | WIHCRGKZMVLHIN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze pentane-1,3,5-trithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentane-1,3,5-trithiol?
The IUPAC name of pentane-1,3,5-trithiol (CID 19807040) is pentane-1,3,5-trithiol.
What is the SMILES notation for pentane-1,3,5-trithiol?
The canonical SMILES for pentane-1,3,5-trithiol is SCCC(S)CCS.
What is the InChIKey of pentane-1,3,5-trithiol?
The InChIKey is WIHCRGKZMVLHIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12S3/c6-3-1-5(8)2-4-7/h5-8H,1-4H2.
What are the key properties of pentane-1,3,5-trithiol?
pentane-1,3,5-trithiol has a molecular weight of 168.35 g/mol, XLogP of 1.92, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentane-1,3,5-trithiol is sourced from PubChem (CID 19807040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).