About 2-ethenylpyrazolo[1,5-a]pyrimidine
2-ethenylpyrazolo[1,5-a]pyrimidine (PubChem CID 19807212) has the molecular formula C8H7N3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-ethenylpyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 2-ethenylpyrazolo[1,5-a]pyrimidine |
| PubChem CID | 19807212 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 2-ethenylpyrazolo[1,5-a]pyrimidine |
| SMILES | C=Cc1cc2ncccn2n1 |
| InChI | InChI=1S/C8H7N3/c1-2-7-6-8-9-4-3-5-11(8)10-7/h2-6H,1H2 |
| InChIKey | OVBRGPZTERECJJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethenylpyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylpyrazolo[1,5-a]pyrimidine?
The IUPAC name of 2-ethenylpyrazolo[1,5-a]pyrimidine (CID 19807212) is 2-ethenylpyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 2-ethenylpyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 2-ethenylpyrazolo[1,5-a]pyrimidine is C=Cc1cc2ncccn2n1.
What is the InChIKey of 2-ethenylpyrazolo[1,5-a]pyrimidine?
The InChIKey is OVBRGPZTERECJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3/c1-2-7-6-8-9-4-3-5-11(8)10-7/h2-6H,1H2.
What are the key properties of 2-ethenylpyrazolo[1,5-a]pyrimidine?
2-ethenylpyrazolo[1,5-a]pyrimidine has a molecular weight of 145.16 g/mol, XLogP of 1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylpyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 19807212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).