About 2,6-bis(trifluoromethyl)-1,2-dihydropyridine
2,6-bis(trifluoromethyl)-1,2-dihydropyridine (PubChem CID 19807243) has the molecular formula C7H5F6N
and a molecular weight of 217.11 g/mol. Its IUPAC name is 2,6-bis(trifluoromethyl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2,6-bis(trifluoromethyl)-1,2-dihydropyridine |
| PubChem CID | 19807243 |
| Molecular Formula | C7H5F6N |
| Molecular Weight | 217.11 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 2,6-bis(trifluoromethyl)-1,2-dihydropyridine |
| SMILES | FC(F)(F)C1=CC=CC(C(F)(F)F)N1 |
| InChI | InChI=1S/C7H5F6N/c8-6(9,10)4-2-1-3-5(14-4)7(11,12)13/h1-4,14H |
| InChIKey | OPMKAZNCAOJORM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.11 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-bis(trifluoromethyl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(trifluoromethyl)-1,2-dihydropyridine?
The IUPAC name of 2,6-bis(trifluoromethyl)-1,2-dihydropyridine (CID 19807243) is 2,6-bis(trifluoromethyl)-1,2-dihydropyridine.
What is the SMILES notation for 2,6-bis(trifluoromethyl)-1,2-dihydropyridine?
The canonical SMILES for 2,6-bis(trifluoromethyl)-1,2-dihydropyridine is FC(F)(F)C1=CC=CC(C(F)(F)F)N1.
What is the InChIKey of 2,6-bis(trifluoromethyl)-1,2-dihydropyridine?
The InChIKey is OPMKAZNCAOJORM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F6N/c8-6(9,10)4-2-1-3-5(14-4)7(11,12)13/h1-4,14H.
What are the key properties of 2,6-bis(trifluoromethyl)-1,2-dihydropyridine?
2,6-bis(trifluoromethyl)-1,2-dihydropyridine has a molecular weight of 217.11 g/mol, XLogP of 2.52, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(trifluoromethyl)-1,2-dihydropyridine is sourced from PubChem (CID 19807243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).