About 7-(3,4-dimethoxyphenyl)-4-hydroxy-5-(hydroxymethyl)-1-benzofuran-6-carboxylic acid
7-(3,4-dimethoxyphenyl)-4-hydroxy-5-(hydroxymethyl)-1-benzofuran-6-carboxylic acid (PubChem CID 19807365) has the molecular formula C18H16O7
and a molecular weight of 344.32 g/mol. Its IUPAC name is 7-(3,4-dimethoxyphenyl)-4-hydroxy-5-(hydroxymethyl)-1-benzofuran-6-carboxylic acid.
Molecular Properties
| Compound Name | 7-(3,4-dimethoxyphenyl)-4-hydroxy-5-(hydroxymethyl)-1-benzofuran-6-carboxylic acid |
| PubChem CID | 19807365 |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 7-(3,4-dimethoxyphenyl)-4-hydroxy-5-(hydroxymethyl)-1-benzofuran-6-carboxylic acid |
| SMILES | COc1ccc(-c2c(C(=O)O)c(CO)c(O)c3ccoc23)cc1OC |
| InChI | InChI=1S/C18H16O7/c1-23-12-4-3-9(7-13(12)24-2)14-15(18(21)22)11(8-19)16(20)10-5-6-25-17(10)14/h3-7,19-20H,8H2,1-2H3,(H,21,22) |
| InChIKey | NQWWIBBCTKOGTK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(3,4-dimethoxyphenyl)-4-hydroxy-5-(hydroxymethyl)-1-benzofuran-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,4-dimethoxyphenyl)-4-hydroxy-5-(hydroxymethyl)-1-benzofuran-6-carboxylic acid?
The IUPAC name of 7-(3,4-dimethoxyphenyl)-4-hydroxy-5-(hydroxymethyl)-1-benzofuran-6-carboxylic acid (CID 19807365) is 7-(3,4-dimethoxyphenyl)-4-hydroxy-5-(hydroxymethyl)-1-benzofuran-6-carboxylic acid.
What is the SMILES notation for 7-(3,4-dimethoxyphenyl)-4-hydroxy-5-(hydroxymethyl)-1-benzofuran-6-carboxylic acid?
The canonical SMILES for 7-(3,4-dimethoxyphenyl)-4-hydroxy-5-(hydroxymethyl)-1-benzofuran-6-carboxylic acid is COc1ccc(-c2c(C(=O)O)c(CO)c(O)c3ccoc23)cc1OC.
What is the InChIKey of 7-(3,4-dimethoxyphenyl)-4-hydroxy-5-(hydroxymethyl)-1-benzofuran-6-carboxylic acid?
The InChIKey is NQWWIBBCTKOGTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O7/c1-23-12-4-3-9(7-13(12)24-2)14-15(18(21)22)11(8-19)16(20)10-5-6-25-17(10)14/h3-7,19-20H,8H2,1-2H3,(H,21,22).
What are the key properties of 7-(3,4-dimethoxyphenyl)-4-hydroxy-5-(hydroxymethyl)-1-benzofuran-6-carboxylic acid?
7-(3,4-dimethoxyphenyl)-4-hydroxy-5-(hydroxymethyl)-1-benzofuran-6-carboxylic acid has a molecular weight of 344.32 g/mol, XLogP of 3.01, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,4-dimethoxyphenyl)-4-hydroxy-5-(hydroxymethyl)-1-benzofuran-6-carboxylic acid is sourced from PubChem (CID 19807365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).