About 1,1'-biphenyl;cyanocarbamic acid
1,1'-biphenyl;cyanocarbamic acid (PubChem CID 19807445) has the molecular formula C14H12N2O2
and a molecular weight of 240.26 g/mol. Its IUPAC name is 1,1'-biphenyl;cyanocarbamic acid.
Molecular Properties
| Compound Name | 1,1'-biphenyl;cyanocarbamic acid |
| PubChem CID | 19807445 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1,1'-biphenyl;cyanocarbamic acid |
| SMILES | N#CNC(=O)O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C2H2N2O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;3-1-4-2(5)6/h1-10H;4H,(H,5,6) |
| InChIKey | WFPGPFFNVAEOQX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;cyanocarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;cyanocarbamic acid?
The IUPAC name of 1,1'-biphenyl;cyanocarbamic acid (CID 19807445) is 1,1'-biphenyl;cyanocarbamic acid.
What is the SMILES notation for 1,1'-biphenyl;cyanocarbamic acid?
The canonical SMILES for 1,1'-biphenyl;cyanocarbamic acid is N#CNC(=O)O.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;cyanocarbamic acid?
The InChIKey is WFPGPFFNVAEOQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C2H2N2O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;3-1-4-2(5)6/h1-10H;4H,(H,5,6).
What are the key properties of 1,1'-biphenyl;cyanocarbamic acid?
1,1'-biphenyl;cyanocarbamic acid has a molecular weight of 240.26 g/mol, XLogP of 3.09, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;cyanocarbamic acid is sourced from PubChem (CID 19807445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).