C23H26F3NOS2 — CID 19807497
3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-5-(trifluoromethyl)-1,3-benzothiazole-2-thione (PubChem CID 19807497) has the molecular formula C23H26F3NOS2 and a molecular weight of 453.60 g/mol. Its IUPAC name is 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-5-(trifluoromethyl)-1,3-benzothiazole-2-thione.
| Compound Name | 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-5-(trifluoromethyl)-1,3-benzothiazole-2-thione |
|---|---|
| PubChem CID | 19807497 |
| Molecular Formula | C23H26F3NOS2 |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-5-(trifluoromethyl)-1,3-benzothiazole-2-thione |
| SMILES | CC(C)(C)c1cc(Cn2c(=S)sc3ccc(C(F)(F)F)cc32)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H26F3NOS2/c1-21(2,3)15-9-13(10-16(19(15)28)22(4,5)6)12-27-17-11-14(23(24,25)26)7-8-18(17)30-20(27)29/h7-11,28H,12H2,1-6H3 |
| InChIKey | YJXLJXQOXJYDJS-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|