C9H11F9 — CID 19807706
3-ethyl-1,1,1,2,3,4,5,5,5-nonafluoro-2,4-dimethylpentane (PubChem CID 19807706) has the molecular formula C9H11F9 and a molecular weight of 290.17 g/mol. Its IUPAC name is 3-ethyl-1,1,1,2,3,4,5,5,5-nonafluoro-2,4-dimethylpentane.
| Compound Name | 3-ethyl-1,1,1,2,3,4,5,5,5-nonafluoro-2,4-dimethylpentane |
|---|---|
| PubChem CID | 19807706 |
| Molecular Formula | C9H11F9 |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-ethyl-1,1,1,2,3,4,5,5,5-nonafluoro-2,4-dimethylpentane |
| SMILES | CCC(F)(C(C)(F)C(F)(F)F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F9/c1-4-7(12,5(2,10)8(13,14)15)6(3,11)9(16,17)18/h4H2,1-3H3 |
| InChIKey | CDPBMWNPYOXWCI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |