C19H19Cl2FN2O2 — CID 19807720
3-chloro-2-[4-chloro-5-(3,6-dihydro-2H-pyran-5-ylmethoxy)-2-fluorophenyl]-4,5,6,7-tetrahydroindazole (PubChem CID 19807720) has the molecular formula C19H19Cl2FN2O2 and a molecular weight of 397.28 g/mol. Its IUPAC name is 3-chloro-2-[4-chloro-5-(3,6-dihydro-2H-pyran-5-ylmethoxy)-2-fluorophenyl]-4,5,6,7-tetrahydroindazole.
| Compound Name | 3-chloro-2-[4-chloro-5-(3,6-dihydro-2H-pyran-5-ylmethoxy)-2-fluorophenyl]-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 19807720 |
| Molecular Formula | C19H19Cl2FN2O2 |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3-chloro-2-[4-chloro-5-(3,6-dihydro-2H-pyran-5-ylmethoxy)-2-fluorophenyl]-4,5,6,7-tetrahydroindazole |
| SMILES | Fc1cc(Cl)c(OCC2=CCCOC2)cc1-n1nc2c(c1Cl)CCCC2 |
| InChI | InChI=1S/C19H19Cl2FN2O2/c20-14-8-15(22)17(9-18(14)26-11-12-4-3-7-25-10-12)24-19(21)13-5-1-2-6-16(13)23-24/h4,8-9H,1-3,5-7,10-11H2 |
| InChIKey | OIAMDOORGZVPBR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|