About 6-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-ol
6-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-ol (PubChem CID 19807756) has the molecular formula C16H11ClF4O2
and a molecular weight of 346.71 g/mol. Its IUPAC name is 6-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 6-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 19807756 |
| Molecular Formula | C16H11ClF4O2 |
| Molecular Weight | 346.71 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 6-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1CCc2ccc(Oc3c(F)cc(C(F)(F)F)cc3Cl)cc21 |
| InChI | InChI=1S/C16H11ClF4O2/c17-12-5-9(16(19,20)21)6-13(18)15(12)23-10-3-1-8-2-4-14(22)11(8)7-10/h1,3,5-7,14,22H,2,4H2 |
| InChIKey | RNAQPSDOSBZECY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.71 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 6-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-ol (CID 19807756) is 6-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 6-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 6-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-ol is OC1CCc2ccc(Oc3c(F)cc(C(F)(F)F)cc3Cl)cc21.
What is the InChIKey of 6-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-ol?
The InChIKey is RNAQPSDOSBZECY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClF4O2/c17-12-5-9(16(19,20)21)6-13(18)15(12)23-10-3-1-8-2-4-14(22)11(8)7-10/h1,3,5-7,14,22H,2,4H2.
What are the key properties of 6-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-ol?
6-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-ol has a molecular weight of 346.71 g/mol, XLogP of 5.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 19807756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).