About 2-octoxypropanoic acid
2-octoxypropanoic acid (PubChem CID 19807849) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is 2-octoxypropanoic acid.
Molecular Properties
| Compound Name | 2-octoxypropanoic acid |
| PubChem CID | 19807849 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 2-octoxypropanoic acid |
| SMILES | CCCCCCCCOC(C)C(=O)O |
| InChI | InChI=1S/C11H22O3/c1-3-4-5-6-7-8-9-14-10(2)11(12)13/h10H,3-9H2,1-2H3,(H,12,13) |
| InChIKey | MMVMJVXMWIJMNI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octoxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octoxypropanoic acid?
The IUPAC name of 2-octoxypropanoic acid (CID 19807849) is 2-octoxypropanoic acid.
What is the SMILES notation for 2-octoxypropanoic acid?
The canonical SMILES for 2-octoxypropanoic acid is CCCCCCCCOC(C)C(=O)O.
What is the InChIKey of 2-octoxypropanoic acid?
The InChIKey is MMVMJVXMWIJMNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-3-4-5-6-7-8-9-14-10(2)11(12)13/h10H,3-9H2,1-2H3,(H,12,13).
What are the key properties of 2-octoxypropanoic acid?
2-octoxypropanoic acid has a molecular weight of 202.29 g/mol, XLogP of 2.84, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octoxypropanoic acid is sourced from PubChem (CID 19807849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).