About 3-hydroxybutan-2-yl pentanoate
3-hydroxybutan-2-yl pentanoate (PubChem CID 19808005) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is 3-hydroxybutan-2-yl pentanoate.
Molecular Properties
| Compound Name | 3-hydroxybutan-2-yl pentanoate |
| PubChem CID | 19808005 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 3-hydroxybutan-2-yl pentanoate |
| SMILES | CCCCC(=O)OC(C)C(C)O |
| InChI | InChI=1S/C9H18O3/c1-4-5-6-9(11)12-8(3)7(2)10/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | NSTGKKNBCWRLLG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-hydroxybutan-2-yl pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxybutan-2-yl pentanoate?
The IUPAC name of 3-hydroxybutan-2-yl pentanoate (CID 19808005) is 3-hydroxybutan-2-yl pentanoate.
What is the SMILES notation for 3-hydroxybutan-2-yl pentanoate?
The canonical SMILES for 3-hydroxybutan-2-yl pentanoate is CCCCC(=O)OC(C)C(C)O.
What is the InChIKey of 3-hydroxybutan-2-yl pentanoate?
The InChIKey is NSTGKKNBCWRLLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3/c1-4-5-6-9(11)12-8(3)7(2)10/h7-8,10H,4-6H2,1-3H3.
What are the key properties of 3-hydroxybutan-2-yl pentanoate?
3-hydroxybutan-2-yl pentanoate has a molecular weight of 174.24 g/mol, XLogP of 1.49, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxybutan-2-yl pentanoate is sourced from PubChem (CID 19808005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).