C11H18N4O4 — CID 19808084
1,4-dimethylpiperazine-2,5-dione;1-methylpiperazine-2,5-dione (PubChem CID 19808084) has the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. Its IUPAC name is 1,4-dimethylpiperazine-2,5-dione;1-methylpiperazine-2,5-dione.
| Compound Name | 1,4-dimethylpiperazine-2,5-dione;1-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 19808084 |
| Molecular Formula | C11H18N4O4 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1,4-dimethylpiperazine-2,5-dione;1-methylpiperazine-2,5-dione |
| SMILES | CN1CC(=O)N(C)CC1=O.CN1CC(=O)NCC1=O |
| InChI | InChI=1S/C6H10N2O2.C5H8N2O2/c1-7-3-6(10)8(2)4-5(7)9;1-7-3-4(8)6-2-5(7)9/h3-4H2,1-2H3;2-3H2,1H3,(H,6,8) |
| InChIKey | ITSFVNSNEZZYJT-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |