2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid

C12H12N2O4 — CID 19808430

IUPAC2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid
SMILESCc1cc2[nH]c(=O)c(=O)n(CC(=O)O)c2cc1C
InChIInChI=1S/C12H12N2O4/c1-6-3-8-9(4-7(6)2)14(5-10(15)16)12(18)11(17)13-8/h3-4H,5H2,1-2H3,(H,13,17)(H,15,16)
InChIKeyKZFIZNJSPIBCFN-UHFFFAOYSA-N
MW248.24 g/mol
LogP0.39
Rot. Bonds2

About 2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid

2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid (PubChem CID 19808430) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid.

Molecular Properties

Compound Name2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid
PubChem CID19808430
Molecular FormulaC12H12N2O4
Molecular Weight248.24 g/mol
Exact Mass248.08
IUPAC Name2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid
SMILESCc1cc2[nH]c(=O)c(=O)n(CC(=O)O)c2cc1C
InChIInChI=1S/C12H12N2O4/c1-6-3-8-9(4-7(6)2)14(5-10(15)16)12(18)11(17)13-8/h3-4H,5H2,1-2H3,(H,13,17)(H,15,16)
InChIKeyKZFIZNJSPIBCFN-UHFFFAOYSA-N
XLogP0.39
TPSA92.16 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.24
LogP ≤ 50.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid?
The IUPAC name of 2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid (CID 19808430) is 2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid.
What is the SMILES notation for 2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid?
The canonical SMILES for 2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid is Cc1cc2[nH]c(=O)c(=O)n(CC(=O)O)c2cc1C.
What is the InChIKey of 2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid?
The InChIKey is KZFIZNJSPIBCFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O4/c1-6-3-8-9(4-7(6)2)14(5-10(15)16)12(18)11(17)13-8/h3-4H,5H2,1-2H3,(H,13,17)(H,15,16).
What are the key properties of 2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid?
2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid has a molecular weight of 248.24 g/mol, XLogP of 0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,7-dimethyl-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid is sourced from PubChem (CID 19808430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).