About 1-[1-(benzenesulfonyl)indol-2-yl]-1-(2,4-dichlorophenyl)ethanol
1-[1-(benzenesulfonyl)indol-2-yl]-1-(2,4-dichlorophenyl)ethanol (PubChem CID 19808809) has the molecular formula C22H17Cl2NO3S
and a molecular weight of 446.36 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)indol-2-yl]-1-(2,4-dichlorophenyl)ethanol.
Molecular Properties
| Compound Name | 1-[1-(benzenesulfonyl)indol-2-yl]-1-(2,4-dichlorophenyl)ethanol |
| PubChem CID | 19808809 |
| Molecular Formula | C22H17Cl2NO3S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | 1-[1-(benzenesulfonyl)indol-2-yl]-1-(2,4-dichlorophenyl)ethanol |
| SMILES | CC(O)(c1ccc(Cl)cc1Cl)c1cc2ccccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H17Cl2NO3S/c1-22(26,18-12-11-16(23)14-19(18)24)21-13-15-7-5-6-10-20(15)25(21)29(27,28)17-8-3-2-4-9-17/h2-14,26H,1H3 |
| InChIKey | BWMMTABILPCBFU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(benzenesulfonyl)indol-2-yl]-1-(2,4-dichlorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(benzenesulfonyl)indol-2-yl]-1-(2,4-dichlorophenyl)ethanol?
The IUPAC name of 1-[1-(benzenesulfonyl)indol-2-yl]-1-(2,4-dichlorophenyl)ethanol (CID 19808809) is 1-[1-(benzenesulfonyl)indol-2-yl]-1-(2,4-dichlorophenyl)ethanol.
What is the SMILES notation for 1-[1-(benzenesulfonyl)indol-2-yl]-1-(2,4-dichlorophenyl)ethanol?
The canonical SMILES for 1-[1-(benzenesulfonyl)indol-2-yl]-1-(2,4-dichlorophenyl)ethanol is CC(O)(c1ccc(Cl)cc1Cl)c1cc2ccccc2n1S(=O)(=O)c1ccccc1.
What is the InChIKey of 1-[1-(benzenesulfonyl)indol-2-yl]-1-(2,4-dichlorophenyl)ethanol?
The InChIKey is BWMMTABILPCBFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17Cl2NO3S/c1-22(26,18-12-11-16(23)14-19(18)24)21-13-15-7-5-6-10-20(15)25(21)29(27,28)17-8-3-2-4-9-17/h2-14,26H,1H3.
What are the key properties of 1-[1-(benzenesulfonyl)indol-2-yl]-1-(2,4-dichlorophenyl)ethanol?
1-[1-(benzenesulfonyl)indol-2-yl]-1-(2,4-dichlorophenyl)ethanol has a molecular weight of 446.36 g/mol, XLogP of 5.44, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(benzenesulfonyl)indol-2-yl]-1-(2,4-dichlorophenyl)ethanol is sourced from PubChem (CID 19808809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).